C24H31N3O — CID 111527517
N'-methyl-N-[(1-phenylcyclopropyl)methyl]-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111527517) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is N'-methyl-N-[(1-phenylcyclopropyl)methyl]-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-N-[(1-phenylcyclopropyl)methyl]-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111527517 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | N'-methyl-N-[(1-phenylcyclopropyl)methyl]-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCC1(c2ccccc2)CC1)N1CCC(COCc2ccccc2)C1 |
| InChI | InChI=1S/C24H31N3O/c1-25-23(26-19-24(13-14-24)22-10-6-3-7-11-22)27-15-12-21(16-27)18-28-17-20-8-4-2-5-9-20/h2-11,21H,12-19H2,1H3,(H,25,26) |
| InChIKey | OAJSKRUWWKPXPK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|