C19H29N3O — CID 119139796
N-(2,2-dimethylcyclopropyl)-N'-methyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 119139796) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is N-(2,2-dimethylcyclopropyl)-N'-methyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-(2,2-dimethylcyclopropyl)-N'-methyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119139796 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | N-(2,2-dimethylcyclopropyl)-N'-methyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NC1CC1(C)C)N1CCC(COCc2ccccc2)C1 |
| InChI | InChI=1S/C19H29N3O/c1-19(2)11-17(19)21-18(20-3)22-10-9-16(12-22)14-23-13-15-7-5-4-6-8-15/h4-8,16-17H,9-14H2,1-3H3,(H,20,21) |
| InChIKey | XTWQCTLXWBYBHA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|