C18H24Cl2F3N3O — CID 109472243
2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109472243) has the molecular formula C18H24Cl2F3N3O and a molecular weight of 426.31 g/mol. Its IUPAC name is 2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109472243 |
| Molecular Formula | C18H24Cl2F3N3O |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CC1(c2ccc(Cl)cc2Cl)CCOCC1)NCCC(F)(F)F |
| InChI | InChI=1S/C18H24Cl2F3N3O/c1-2-24-16(25-8-5-18(21,22)23)26-12-17(6-9-27-10-7-17)14-4-3-13(19)11-15(14)20/h3-4,11H,2,5-10,12H2,1H3,(H2,24,25,26) |
| InChIKey | VENLSFUJUDLBTL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|