C19H28Cl2IN3O — CID 111870736
1-(cyclopropylmethyl)-2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111870736) has the molecular formula C19H28Cl2IN3O and a molecular weight of 512.26 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-(cyclopropylmethyl)-2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111870736 |
| Molecular Formula | C19H28Cl2IN3O |
| Molecular Weight | 512.26 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 1-(cyclopropylmethyl)-2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2ccc(Cl)cc2Cl)CCOCC1)NCC1CC1.I |
| InChI | InChI=1S/C19H27Cl2N3O.HI/c1-2-22-18(23-12-14-3-4-14)24-13-19(7-9-25-10-8-19)16-6-5-15(20)11-17(16)21;/h5-6,11,14H,2-4,7-10,12-13H2,1H3,(H2,22,23,24);1H |
| InChIKey | GDTPDBYTGVQBDI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|