C18H26Cl2IN3O — CID 111081399
1-(cyclobutylmethyl)-2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111081399) has the molecular formula C18H26Cl2IN3O and a molecular weight of 498.24 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(cyclobutylmethyl)-2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111081399 |
| Molecular Formula | C18H26Cl2IN3O |
| Molecular Weight | 498.24 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1(c2ccc(Cl)cc2Cl)CCOCC1)NCC1CCC1 |
| InChI | InChI=1S/C18H25Cl2N3O.HI/c19-14-4-5-15(16(20)10-14)18(6-8-24-9-7-18)12-23-17(21)22-11-13-2-1-3-13;/h4-5,10,13H,1-3,6-9,11-12H2,(H3,21,22,23);1H |
| InChIKey | VOVFOXSPSCBRAE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.24 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|