C18H23Cl2N3O — CID 111850052
2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-1-ethyl-3-prop-2-ynylguanidine (PubChem CID 111850052) has the molecular formula C18H23Cl2N3O and a molecular weight of 368.31 g/mol. Its IUPAC name is 2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-1-ethyl-3-prop-2-ynylguanidine.
| Compound Name | 2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-1-ethyl-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 111850052 |
| Molecular Formula | C18H23Cl2N3O |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-1-ethyl-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N/CC1(c2ccc(Cl)cc2Cl)CCOCC1)NCC |
| InChI | InChI=1S/C18H23Cl2N3O/c1-3-9-22-17(21-4-2)23-13-18(7-10-24-11-8-18)15-6-5-14(19)12-16(15)20/h1,5-6,12H,4,7-11,13H2,2H3,(H2,21,22,23) |
| InChIKey | LOMXOTAVHVDSKH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|