C20H30ClN3O2 — CID 111961223
2-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-1-ethyl-3-(2-methylcyclopropyl)guanidine (PubChem CID 111961223) has the molecular formula C20H30ClN3O2 and a molecular weight of 379.93 g/mol. Its IUPAC name is 2-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-1-ethyl-3-(2-methylcyclopropyl)guanidine.
| Compound Name | 2-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-1-ethyl-3-(2-methylcyclopropyl)guanidine |
|---|---|
| PubChem CID | 111961223 |
| Molecular Formula | C20H30ClN3O2 |
| Molecular Weight | 379.93 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 2-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-1-ethyl-3-(2-methylcyclopropyl)guanidine |
| SMILES | CCN/C(=N\CC1(c2cc(Cl)ccc2OC)CCOCC1)NC1CC1C |
| InChI | InChI=1S/C20H30ClN3O2/c1-4-22-19(24-17-11-14(17)2)23-13-20(7-9-26-10-8-20)16-12-15(21)5-6-18(16)25-3/h5-6,12,14,17H,4,7-11,13H2,1-3H3,(H2,22,23,24) |
| InChIKey | STLXUSZXLWDIHA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.93 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|