C23H28ClN3O2 — CID 111080827
2-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-1-(2,3-dihydro-1H-inden-5-yl)guanidine (PubChem CID 111080827) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 2-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-1-(2,3-dihydro-1H-inden-5-yl)guanidine.
| Compound Name | 2-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-1-(2,3-dihydro-1H-inden-5-yl)guanidine |
|---|---|
| PubChem CID | 111080827 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 2-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-1-(2,3-dihydro-1H-inden-5-yl)guanidine |
| SMILES | COc1ccc(Cl)cc1C1(C/N=C(\N)Nc2ccc3c(c2)CCC3)CCOCC1 |
| InChI | InChI=1S/C23H28ClN3O2/c1-28-21-8-6-18(24)14-20(21)23(9-11-29-12-10-23)15-26-22(25)27-19-7-5-16-3-2-4-17(16)13-19/h5-8,13-14H,2-4,9-12,15H2,1H3,(H3,25,26,27) |
| InChIKey | GXBQCMAZALHCSN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|