C18H28ClN3O2 — CID 111080809
2-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-1,1-diethylguanidine (PubChem CID 111080809) has the molecular formula C18H28ClN3O2 and a molecular weight of 353.89 g/mol. Its IUPAC name is 2-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-1,1-diethylguanidine.
| Compound Name | 2-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-1,1-diethylguanidine |
|---|---|
| PubChem CID | 111080809 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 2-[[4-(5-chloro-2-methoxyphenyl)oxan-4-yl]methyl]-1,1-diethylguanidine |
| SMILES | CCN(CC)/C(N)=N/CC1(c2cc(Cl)ccc2OC)CCOCC1 |
| InChI | InChI=1S/C18H28ClN3O2/c1-4-22(5-2)17(20)21-13-18(8-10-24-11-9-18)15-12-14(19)6-7-16(15)23-3/h6-7,12H,4-5,8-11,13H2,1-3H3,(H2,20,21) |
| InChIKey | HXJMLPWPWLRITE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|