C18H30IN3O2 — CID 111081287
1,1-diethyl-2-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111081287) has the molecular formula C18H30IN3O2 and a molecular weight of 447.36 g/mol. Its IUPAC name is 1,1-diethyl-2-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1,1-diethyl-2-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111081287 |
| Molecular Formula | C18H30IN3O2 |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 1,1-diethyl-2-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/CC1(c2ccc(OC)cc2)CCOCC1.I |
| InChI | InChI=1S/C18H29N3O2.HI/c1-4-21(5-2)17(19)20-14-18(10-12-23-13-11-18)15-6-8-16(22-3)9-7-15;/h6-9H,4-5,10-14H2,1-3H3,(H2,19,20);1H |
| InChIKey | YVIMHHXRCUAYJJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|