C19H24Cl2IN3OS — CID 111081389
2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111081389) has the molecular formula C19H24Cl2IN3OS and a molecular weight of 540.30 g/mol. Its IUPAC name is 2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111081389 |
| Molecular Formula | C19H24Cl2IN3OS |
| Molecular Weight | 540.30 g/mol |
| Exact Mass | 539.01 |
| IUPAC Name | 2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1(c2ccc(Cl)cc2Cl)CCOCC1)NCCc1cccs1 |
| InChI | InChI=1S/C19H23Cl2N3OS.HI/c20-14-3-4-16(17(21)12-14)19(6-9-25-10-7-19)13-24-18(22)23-8-5-15-2-1-11-26-15;/h1-4,11-12H,5-10,13H2,(H3,22,23,24);1H |
| InChIKey | XYFUTGRTXFNGJX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.30 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|