C16H24ClFN4O — CID 111187317
2-[(3-chloro-4-fluorophenyl)methyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine (PubChem CID 111187317) has the molecular formula C16H24ClFN4O and a molecular weight of 342.85 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 111187317 |
| Molecular Formula | C16H24ClFN4O |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(F)c(Cl)c1)NCCN1CCOCC1 |
| InChI | InChI=1S/C16H24ClFN4O/c1-2-19-16(20-5-6-22-7-9-23-10-8-22)21-12-13-3-4-15(18)14(17)11-13/h3-4,11H,2,5-10,12H2,1H3,(H2,19,20,21) |
| InChIKey | YXEIURVPZVQZPD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|