C10H13Cl2N3 — CID 111024875
2-[(2,4-dichlorophenyl)methyl]-1-ethylguanidine (PubChem CID 111024875) has the molecular formula C10H13Cl2N3 and a molecular weight of 246.14 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-ethylguanidine.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethylguanidine |
|---|---|
| PubChem CID | 111024875 |
| Molecular Formula | C10H13Cl2N3 |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethylguanidine |
| SMILES | CCN/C(N)=N/Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H13Cl2N3/c1-2-14-10(13)15-6-7-3-4-8(11)5-9(7)12/h3-5H,2,6H2,1H3,(H3,13,14,15) |
| InChIKey | LMJURUUSQIMWIC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|