C14H18Cl2N6 — CID 111197822
2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111197822) has the molecular formula C14H18Cl2N6 and a molecular weight of 341.25 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111197822 |
| Molecular Formula | C14H18Cl2N6 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCc1nncn1C |
| InChI | InChI=1S/C14H18Cl2N6/c1-3-17-14(19-8-13-21-20-9-22(13)2)18-7-10-4-5-11(15)6-12(10)16/h4-6,9H,3,7-8H2,1-2H3,(H2,17,18,19) |
| InChIKey | COXRQGGDDKGVOX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|