C13H19Cl2N3 — CID 111024821
2-[(2,4-dichlorophenyl)methyl]-1-(3-methylbutyl)guanidine (PubChem CID 111024821) has the molecular formula C13H19Cl2N3 and a molecular weight of 288.22 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-(3-methylbutyl)guanidine.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-(3-methylbutyl)guanidine |
|---|---|
| PubChem CID | 111024821 |
| Molecular Formula | C13H19Cl2N3 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-(3-methylbutyl)guanidine |
| SMILES | CC(C)CCN/C(N)=N/Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H19Cl2N3/c1-9(2)5-6-17-13(16)18-8-10-3-4-11(14)7-12(10)15/h3-4,7,9H,5-6,8H2,1-2H3,(H3,16,17,18) |
| InChIKey | LPOYVTILXIPQGU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|