C16H16Cl3N5 — CID 15598981
1-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-2-[(2,4-dichlorophenyl)methyl]guanidine (PubChem CID 15598981) has the molecular formula C16H16Cl3N5 and a molecular weight of 384.70 g/mol. Its IUPAC name is 1-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-2-[(2,4-dichlorophenyl)methyl]guanidine.
| Compound Name | 1-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-2-[(2,4-dichlorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 15598981 |
| Molecular Formula | C16H16Cl3N5 |
| Molecular Weight | 384.70 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 1-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-2-[(2,4-dichlorophenyl)methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(Cl)cc1)N/C(N)=N/Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl3N5/c17-12-4-1-10(2-5-12)8-22-15(20)24-16(21)23-9-11-3-6-13(18)7-14(11)19/h1-7H,8-9H2,(H5,20,21,22,23,24) |
| InChIKey | GNRHJCJPGSPGHI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.70 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|