C18H19ClN4O5 — CID 118709823
N-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-2-(4,5-dimethoxy-2-nitrophenyl)acetamide (PubChem CID 118709823) has the molecular formula C18H19ClN4O5 and a molecular weight of 406.83 g/mol. Its IUPAC name is N-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-2-(4,5-dimethoxy-2-nitrophenyl)acetamide.
| Compound Name | N-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-2-(4,5-dimethoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 118709823 |
| Molecular Formula | C18H19ClN4O5 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | N-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-2-(4,5-dimethoxy-2-nitrophenyl)acetamide |
| SMILES | COc1cc(CC(=O)N/C(N)=N/Cc2ccc(Cl)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H19ClN4O5/c1-27-15-7-12(14(23(25)26)9-16(15)28-2)8-17(24)22-18(20)21-10-11-3-5-13(19)6-4-11/h3-7,9H,8,10H2,1-2H3,(H3,20,21,22,24) |
| InChIKey | XSNYMTFMUGNRCZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|