C12H15N2O6Se — CID 144773362
CID 144773362 (PubChem CID 144773362) has the molecular formula C12H15N2O6Se and a molecular weight of 362.22 g/mol.
| Compound Name | CID 144773362 |
|---|---|
| PubChem CID | 144773362 |
| Molecular Formula | C12H15N2O6Se |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | — |
| SMILES | COc1cc(CN[C@@H](C[Se])C(=O)O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C12H15N2O6Se/c1-19-10-3-7(5-13-8(6-21)12(15)16)9(14(17)18)4-11(10)20-2/h3-4,8,13H,5-6H2,1-2H3,(H,15,16)/t8-/m0/s1 |
| InChIKey | DHRPLIUBZOKAFD-QMMMGPOBSA-N |
| XLogP | 0.74 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|