C13H16N2O8 — CID 118912666
(2S)-2-amino-4-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-4-oxobutanoic acid (PubChem CID 118912666) has the molecular formula C13H16N2O8 and a molecular weight of 328.28 g/mol. Its IUPAC name is (2S)-2-amino-4-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-4-oxobutanoic acid.
| Compound Name | (2S)-2-amino-4-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 118912666 |
| Molecular Formula | C13H16N2O8 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (2S)-2-amino-4-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-4-oxobutanoic acid |
| SMILES | COc1cc(COC(=O)C[C@H](N)C(=O)O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C13H16N2O8/c1-21-10-3-7(9(15(19)20)5-11(10)22-2)6-23-12(16)4-8(14)13(17)18/h3,5,8H,4,6,14H2,1-2H3,(H,17,18)/t8-/m0/s1 |
| InChIKey | XVCXMBHKGZZDNN-QMMMGPOBSA-N |
| XLogP | 0.46 |
| TPSA | 151.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|