C10H10NNaO6 — CID 155726894
sodium (4,5-dimethoxy-2-nitrophenyl)methoxymethanone (PubChem CID 155726894) has the molecular formula C10H10NNaO6 and a molecular weight of 263.18 g/mol. Its IUPAC name is sodium (4,5-dimethoxy-2-nitrophenyl)methoxymethanone.
| Compound Name | sodium (4,5-dimethoxy-2-nitrophenyl)methoxymethanone |
|---|---|
| PubChem CID | 155726894 |
| Molecular Formula | C10H10NNaO6 |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | sodium (4,5-dimethoxy-2-nitrophenyl)methoxymethanone |
| SMILES | COc1cc(CO[C-]=O)c([N+](=O)[O-])cc1OC.[Na+] |
| InChI | InChI=1S/C10H10NO6.Na/c1-15-9-3-7(5-17-6-12)8(11(13)14)4-10(9)16-2;/h3-4H,5H2,1-2H3;/q-1;+1 |
| InChIKey | VWJNDAYGWPRVRJ-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|