C25H34N2O12 — CID 160819658
bis((4,5-dimethoxy-2-nitrophenyl)methyl propanoate);methane (PubChem CID 160819658) has the molecular formula C25H34N2O12 and a molecular weight of 554.55 g/mol. Its IUPAC name is bis((4,5-dimethoxy-2-nitrophenyl)methyl propanoate);methane.
| Compound Name | bis((4,5-dimethoxy-2-nitrophenyl)methyl propanoate);methane |
|---|---|
| PubChem CID | 160819658 |
| Molecular Formula | C25H34N2O12 |
| Molecular Weight | 554.55 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | bis((4,5-dimethoxy-2-nitrophenyl)methyl propanoate);methane |
| SMILES | C.CCC(=O)OCc1cc(OC)c(OC)cc1[N+](=O)[O-].CCC(=O)OCc1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/2C12H15NO6.CH4/c2*1-4-12(14)19-7-8-5-10(17-2)11(18-3)6-9(8)13(15)16;/h2*5-6H,4,7H2,1-3H3;1H4 |
| InChIKey | SFJFPAJTQZAHKP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 175.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|