C22H32N2O6 — CID 67004053
(4,5-dimethoxy-2-nitrophenyl)methyl N,N-dicyclohexylcarbamate (PubChem CID 67004053) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is (4,5-dimethoxy-2-nitrophenyl)methyl N,N-dicyclohexylcarbamate.
| Compound Name | (4,5-dimethoxy-2-nitrophenyl)methyl N,N-dicyclohexylcarbamate |
|---|---|
| PubChem CID | 67004053 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (4,5-dimethoxy-2-nitrophenyl)methyl N,N-dicyclohexylcarbamate |
| SMILES | COc1cc(COC(=O)N(C2CCCCC2)C2CCCCC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C22H32N2O6/c1-28-20-13-16(19(24(26)27)14-21(20)29-2)15-30-22(25)23(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h13-14,17-18H,3-12,15H2,1-2H3 |
| InChIKey | GTQNPTBXKPYDLB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|