C22H35N3O4 — CID 23769453
4-N-(cyclohexylmethyl)-4-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]cyclohexane-1,4-diamine (PubChem CID 23769453) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is 4-N-(cyclohexylmethyl)-4-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-(cyclohexylmethyl)-4-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 23769453 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 4-N-(cyclohexylmethyl)-4-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]cyclohexane-1,4-diamine |
| SMILES | COc1cc(CN(CC2CCCCC2)C2CCC(N)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C22H35N3O4/c1-28-21-12-17(20(25(26)27)13-22(21)29-2)15-24(14-16-6-4-3-5-7-16)19-10-8-18(23)9-11-19/h12-13,16,18-19H,3-11,14-15,23H2,1-2H3 |
| InChIKey | FHODFEZTFFBFEG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|