C18H24N2O7 — CID 2570393
[2-(cycloheptylamino)-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 2570393) has the molecular formula C18H24N2O7 and a molecular weight of 380.40 g/mol. Its IUPAC name is [2-(cycloheptylamino)-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [2-(cycloheptylamino)-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 2570393 |
| Molecular Formula | C18H24N2O7 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [2-(cycloheptylamino)-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)NC2CCCCCC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H24N2O7/c1-25-15-9-13(14(20(23)24)10-16(15)26-2)18(22)27-11-17(21)19-12-7-5-3-4-6-8-12/h9-10,12H,3-8,11H2,1-2H3,(H,19,21) |
| InChIKey | YQRKKBNQCBZEAM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|