C21H33N3O3 — CID 23734149
4-N-(cyclohexylmethyl)-4-N-[(4-methoxy-3-nitrophenyl)methyl]cyclohexane-1,4-diamine (PubChem CID 23734149) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is 4-N-(cyclohexylmethyl)-4-N-[(4-methoxy-3-nitrophenyl)methyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-(cyclohexylmethyl)-4-N-[(4-methoxy-3-nitrophenyl)methyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 23734149 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | 4-N-(cyclohexylmethyl)-4-N-[(4-methoxy-3-nitrophenyl)methyl]cyclohexane-1,4-diamine |
| SMILES | COc1ccc(CN(CC2CCCCC2)C2CCC(N)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H33N3O3/c1-27-21-12-7-17(13-20(21)24(25)26)15-23(14-16-5-3-2-4-6-16)19-10-8-18(22)9-11-19/h7,12-13,16,18-19H,2-6,8-11,14-15,22H2,1H3 |
| InChIKey | JRGDZLUFFPZANR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|