C12H17Cl3N2O3 — CID 12642797
2-chloro-N-(2-chloroethyl)-N-[(4-methoxy-3-nitrophenyl)methyl]ethanamine;hydrochloride (PubChem CID 12642797) has the molecular formula C12H17Cl3N2O3 and a molecular weight of 343.64 g/mol. Its IUPAC name is 2-chloro-N-(2-chloroethyl)-N-[(4-methoxy-3-nitrophenyl)methyl]ethanamine;hydrochloride.
| Compound Name | 2-chloro-N-(2-chloroethyl)-N-[(4-methoxy-3-nitrophenyl)methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 12642797 |
| Molecular Formula | C12H17Cl3N2O3 |
| Molecular Weight | 343.64 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 2-chloro-N-(2-chloroethyl)-N-[(4-methoxy-3-nitrophenyl)methyl]ethanamine;hydrochloride |
| SMILES | COc1ccc(CN(CCCl)CCCl)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C12H16Cl2N2O3.ClH/c1-19-12-3-2-10(8-11(12)16(17)18)9-15(6-4-13)7-5-14;/h2-3,8H,4-7,9H2,1H3;1H |
| InChIKey | KQBVNBUWPUIXDB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.64 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|