C14H24ClN3O3 — CID 119928805
N'-[(4-methoxy-3-nitrophenyl)methyl]-N',2,2-trimethylpropane-1,3-diamine;hydrochloride (PubChem CID 119928805) has the molecular formula C14H24ClN3O3 and a molecular weight of 317.82 g/mol. Its IUPAC name is N'-[(4-methoxy-3-nitrophenyl)methyl]-N',2,2-trimethylpropane-1,3-diamine;hydrochloride.
| Compound Name | N'-[(4-methoxy-3-nitrophenyl)methyl]-N',2,2-trimethylpropane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 119928805 |
| Molecular Formula | C14H24ClN3O3 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N'-[(4-methoxy-3-nitrophenyl)methyl]-N',2,2-trimethylpropane-1,3-diamine;hydrochloride |
| SMILES | COc1ccc(CN(C)CC(C)(C)CN)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C14H23N3O3.ClH/c1-14(2,9-15)10-16(3)8-11-5-6-13(20-4)12(7-11)17(18)19;/h5-7H,8-10,15H2,1-4H3;1H |
| InChIKey | RHOSNQFZAALKRG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|