C16H25N3O4 — CID 87015074
2-[(4-methoxy-3-nitrophenyl)methyl-propylamino]-N-propylacetamide (PubChem CID 87015074) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-[(4-methoxy-3-nitrophenyl)methyl-propylamino]-N-propylacetamide.
| Compound Name | 2-[(4-methoxy-3-nitrophenyl)methyl-propylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 87015074 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 2-[(4-methoxy-3-nitrophenyl)methyl-propylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(CCC)Cc1ccc(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H25N3O4/c1-4-8-17-16(20)12-18(9-5-2)11-13-6-7-15(23-3)14(10-13)19(21)22/h6-7,10H,4-5,8-9,11-12H2,1-3H3,(H,17,20) |
| InChIKey | FUZCIAKCSFOBJR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|