C22H35N3O — CID 23853695
N-[4-[[(4-aminocyclohexyl)-(cyclohexylmethyl)amino]methyl]phenyl]acetamide (PubChem CID 23853695) has the molecular formula C22H35N3O and a molecular weight of 357.54 g/mol. Its IUPAC name is N-[4-[[(4-aminocyclohexyl)-(cyclohexylmethyl)amino]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[(4-aminocyclohexyl)-(cyclohexylmethyl)amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 23853695 |
| Molecular Formula | C22H35N3O |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | N-[4-[[(4-aminocyclohexyl)-(cyclohexylmethyl)amino]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CN(CC2CCCCC2)C2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C22H35N3O/c1-17(26)24-21-11-7-19(8-12-21)16-25(15-18-5-3-2-4-6-18)22-13-9-20(23)10-14-22/h7-8,11-12,18,20,22H,2-6,9-10,13-16,23H2,1H3,(H,24,26) |
| InChIKey | STJCICRQICKGFP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |