C22H25F2N3O2 — CID 23738640
N-[(4-acetamidophenyl)methyl]-N-(4-aminocyclohexyl)-3,5-difluorobenzamide (PubChem CID 23738640) has the molecular formula C22H25F2N3O2 and a molecular weight of 401.46 g/mol. Its IUPAC name is N-[(4-acetamidophenyl)methyl]-N-(4-aminocyclohexyl)-3,5-difluorobenzamide.
| Compound Name | N-[(4-acetamidophenyl)methyl]-N-(4-aminocyclohexyl)-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 23738640 |
| Molecular Formula | C22H25F2N3O2 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[(4-acetamidophenyl)methyl]-N-(4-aminocyclohexyl)-3,5-difluorobenzamide |
| SMILES | CC(=O)Nc1ccc(CN(C(=O)c2cc(F)cc(F)c2)C2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C22H25F2N3O2/c1-14(28)26-20-6-2-15(3-7-20)13-27(21-8-4-19(25)5-9-21)22(29)16-10-17(23)12-18(24)11-16/h2-3,6-7,10-12,19,21H,4-5,8-9,13,25H2,1H3,(H,26,28) |
| InChIKey | LLZVURAGRUPEMJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |