C16H14F2N2O — CID 47017136
N-cyclopropyl-3,5-difluoro-N-(pyridin-4-ylmethyl)benzamide (PubChem CID 47017136) has the molecular formula C16H14F2N2O and a molecular weight of 288.30 g/mol. Its IUPAC name is N-cyclopropyl-3,5-difluoro-N-(pyridin-4-ylmethyl)benzamide.
| Compound Name | N-cyclopropyl-3,5-difluoro-N-(pyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 47017136 |
| Molecular Formula | C16H14F2N2O |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-cyclopropyl-3,5-difluoro-N-(pyridin-4-ylmethyl)benzamide |
| SMILES | O=C(c1cc(F)cc(F)c1)N(Cc1ccncc1)C1CC1 |
| InChI | InChI=1S/C16H14F2N2O/c17-13-7-12(8-14(18)9-13)16(21)20(15-1-2-15)10-11-3-5-19-6-4-11/h3-9,15H,1-2,10H2 |
| InChIKey | SHZCBJPCXZMZDL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |