C19H20N2OS2 — CID 86919919
N-cyclopropyl-4-(1,3-dithiolan-2-yl)-N-(pyridin-4-ylmethyl)benzamide (PubChem CID 86919919) has the molecular formula C19H20N2OS2 and a molecular weight of 356.52 g/mol. Its IUPAC name is N-cyclopropyl-4-(1,3-dithiolan-2-yl)-N-(pyridin-4-ylmethyl)benzamide.
| Compound Name | N-cyclopropyl-4-(1,3-dithiolan-2-yl)-N-(pyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 86919919 |
| Molecular Formula | C19H20N2OS2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-cyclopropyl-4-(1,3-dithiolan-2-yl)-N-(pyridin-4-ylmethyl)benzamide |
| SMILES | O=C(c1ccc(C2SCCS2)cc1)N(Cc1ccncc1)C1CC1 |
| InChI | InChI=1S/C19H20N2OS2/c22-18(15-1-3-16(4-2-15)19-23-11-12-24-19)21(17-5-6-17)13-14-7-9-20-10-8-14/h1-4,7-10,17,19H,5-6,11-13H2 |
| InChIKey | FAUMWEFZXAJJRI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |