C16H21NO3S3 — CID 41076534
N-[(3R)-1,1-dioxothiolan-3-yl]-4-(1,3-dithiolan-2-yl)-N-ethylbenzamide (PubChem CID 41076534) has the molecular formula C16H21NO3S3 and a molecular weight of 371.55 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-4-(1,3-dithiolan-2-yl)-N-ethylbenzamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-4-(1,3-dithiolan-2-yl)-N-ethylbenzamide |
|---|---|
| PubChem CID | 41076534 |
| Molecular Formula | C16H21NO3S3 |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-4-(1,3-dithiolan-2-yl)-N-ethylbenzamide |
| SMILES | CCN(C(=O)c1ccc(C2SCCS2)cc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H21NO3S3/c1-2-17(14-7-10-23(19,20)11-14)15(18)12-3-5-13(6-4-12)16-21-8-9-22-16/h3-6,14,16H,2,7-11H2,1H3/t14-/m1/s1 |
| InChIKey | PJAYGLKENUZUOI-CQSZACIVSA-N |
| XLogP | 2.81 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |