C11H14INO3S2 — CID 78948953
N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-iodothiophene-3-carboxamide (PubChem CID 78948953) has the molecular formula C11H14INO3S2 and a molecular weight of 399.28 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-iodothiophene-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 78948953 |
| Molecular Formula | C11H14INO3S2 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.95 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-5-iodothiophene-3-carboxamide |
| SMILES | CCN(C(=O)c1csc(I)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H14INO3S2/c1-2-13(9-3-4-18(15,16)7-9)11(14)8-5-10(12)17-6-8/h5-6,9H,2-4,7H2,1H3 |
| InChIKey | ZQQKUYVQOGIKNC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|