C27H26F2N4O4 — CID 23995638
N-(4-aminocyclohexyl)-3,5-difluoro-N-[[3-[(4-nitrobenzoyl)amino]phenyl]methyl]benzamide (PubChem CID 23995638) has the molecular formula C27H26F2N4O4 and a molecular weight of 508.53 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3,5-difluoro-N-[[3-[(4-nitrobenzoyl)amino]phenyl]methyl]benzamide.
| Compound Name | N-(4-aminocyclohexyl)-3,5-difluoro-N-[[3-[(4-nitrobenzoyl)amino]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 23995638 |
| Molecular Formula | C27H26F2N4O4 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | N-(4-aminocyclohexyl)-3,5-difluoro-N-[[3-[(4-nitrobenzoyl)amino]phenyl]methyl]benzamide |
| SMILES | NC1CCC(N(Cc2cccc(NC(=O)c3ccc([N+](=O)[O-])cc3)c2)C(=O)c2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C27H26F2N4O4/c28-20-13-19(14-21(29)15-20)27(35)32(24-10-6-22(30)7-11-24)16-17-2-1-3-23(12-17)31-26(34)18-4-8-25(9-5-18)33(36)37/h1-5,8-9,12-15,22,24H,6-7,10-11,16,30H2,(H,31,34) |
| InChIKey | XHWJTUUHQBKTSB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|