C36H43N5O4 — CID 23739134
N-[5-[3-[[(4-aminocyclohexyl)-(cyclopropanecarbonyl)amino]methyl]phenyl]-2-(azepan-1-yl)phenyl]-4-nitrobenzamide (PubChem CID 23739134) has the molecular formula C36H43N5O4 and a molecular weight of 609.77 g/mol. Its IUPAC name is N-[5-[3-[[(4-aminocyclohexyl)-(cyclopropanecarbonyl)amino]methyl]phenyl]-2-(azepan-1-yl)phenyl]-4-nitrobenzamide.
| Compound Name | N-[5-[3-[[(4-aminocyclohexyl)-(cyclopropanecarbonyl)amino]methyl]phenyl]-2-(azepan-1-yl)phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 23739134 |
| Molecular Formula | C36H43N5O4 |
| Molecular Weight | 609.77 g/mol |
| Exact Mass | 609.33 |
| IUPAC Name | N-[5-[3-[[(4-aminocyclohexyl)-(cyclopropanecarbonyl)amino]methyl]phenyl]-2-(azepan-1-yl)phenyl]-4-nitrobenzamide |
| SMILES | NC1CCC(N(Cc2cccc(-c3ccc(N4CCCCCC4)c(NC(=O)c4ccc([N+](=O)[O-])cc4)c3)c2)C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C36H43N5O4/c37-30-13-17-31(18-14-30)40(36(43)27-8-9-27)24-25-6-5-7-28(22-25)29-12-19-34(39-20-3-1-2-4-21-39)33(23-29)38-35(42)26-10-15-32(16-11-26)41(44)45/h5-7,10-12,15-16,19,22-23,27,30-31H,1-4,8-9,13-14,17-18,20-21,24,37H2,(H,38,42) |
| InChIKey | ANECNPFYHQLYEI-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.77 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|