C26H31N3O5 — CID 23958752
3-[[3-[4-(azepan-1-yl)-3-nitrophenyl]phenyl]methyl-(cyclopropanecarbonyl)amino]propanoic acid (PubChem CID 23958752) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is 3-[[3-[4-(azepan-1-yl)-3-nitrophenyl]phenyl]methyl-(cyclopropanecarbonyl)amino]propanoic acid.
| Compound Name | 3-[[3-[4-(azepan-1-yl)-3-nitrophenyl]phenyl]methyl-(cyclopropanecarbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 23958752 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 3-[[3-[4-(azepan-1-yl)-3-nitrophenyl]phenyl]methyl-(cyclopropanecarbonyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(Cc1cccc(-c2ccc(N3CCCCCC3)c([N+](=O)[O-])c2)c1)C(=O)C1CC1 |
| InChI | InChI=1S/C26H31N3O5/c30-25(31)12-15-28(26(32)20-8-9-20)18-19-6-5-7-21(16-19)22-10-11-23(24(17-22)29(33)34)27-13-3-1-2-4-14-27/h5-7,10-11,16-17,20H,1-4,8-9,12-15,18H2,(H,30,31) |
| InChIKey | STKHEKYPCJWBMR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|