C29H35N5O6 — CID 23733936
3-[(3-tert-butyl-1-methylpyrazole-5-carbonyl)-[[3-(4-morpholin-4-yl-3-nitrophenyl)phenyl]methyl]amino]propanoic acid (PubChem CID 23733936) has the molecular formula C29H35N5O6 and a molecular weight of 549.63 g/mol. Its IUPAC name is 3-[(3-tert-butyl-1-methylpyrazole-5-carbonyl)-[[3-(4-morpholin-4-yl-3-nitrophenyl)phenyl]methyl]amino]propanoic acid.
| Compound Name | 3-[(3-tert-butyl-1-methylpyrazole-5-carbonyl)-[[3-(4-morpholin-4-yl-3-nitrophenyl)phenyl]methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23733936 |
| Molecular Formula | C29H35N5O6 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | 3-[(3-tert-butyl-1-methylpyrazole-5-carbonyl)-[[3-(4-morpholin-4-yl-3-nitrophenyl)phenyl]methyl]amino]propanoic acid |
| SMILES | Cn1nc(C(C)(C)C)cc1C(=O)N(CCC(=O)O)Cc1cccc(-c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C29H35N5O6/c1-29(2,3)26-18-25(31(4)30-26)28(37)33(11-10-27(35)36)19-20-6-5-7-21(16-20)22-8-9-23(24(17-22)34(38)39)32-12-14-40-15-13-32/h5-9,16-18H,10-15,19H2,1-4H3,(H,35,36) |
| InChIKey | TVTKNTNNBNJUEH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 131.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|