C29H36N6O5 — CID 23770565
N-(4-aminocyclohexyl)-4-[4-(cyclobutanecarbonyl)piperazin-1-yl]-3-[(4-nitrobenzoyl)amino]benzamide (PubChem CID 23770565) has the molecular formula C29H36N6O5 and a molecular weight of 548.64 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-4-[4-(cyclobutanecarbonyl)piperazin-1-yl]-3-[(4-nitrobenzoyl)amino]benzamide.
| Compound Name | N-(4-aminocyclohexyl)-4-[4-(cyclobutanecarbonyl)piperazin-1-yl]-3-[(4-nitrobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 23770565 |
| Molecular Formula | C29H36N6O5 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | N-(4-aminocyclohexyl)-4-[4-(cyclobutanecarbonyl)piperazin-1-yl]-3-[(4-nitrobenzoyl)amino]benzamide |
| SMILES | NC1CCC(NC(=O)c2ccc(N3CCN(C(=O)C4CCC4)CC3)c(NC(=O)c3ccc([N+](=O)[O-])cc3)c2)CC1 |
| InChI | InChI=1S/C29H36N6O5/c30-22-7-9-23(10-8-22)31-28(37)21-6-13-26(33-14-16-34(17-15-33)29(38)20-2-1-3-20)25(18-21)32-27(36)19-4-11-24(12-5-19)35(39)40/h4-6,11-13,18,20,22-23H,1-3,7-10,14-17,30H2,(H,31,37)(H,32,36) |
| InChIKey | XNWQGKQXJOXNFL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|