C33H39N5O3 — CID 23990654
N-(4-aminocyclohexyl)-4-(4-benzoyl-1,4-diazepan-1-yl)-3-[(3-methylbenzoyl)amino]benzamide (PubChem CID 23990654) has the molecular formula C33H39N5O3 and a molecular weight of 553.71 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-4-(4-benzoyl-1,4-diazepan-1-yl)-3-[(3-methylbenzoyl)amino]benzamide.
| Compound Name | N-(4-aminocyclohexyl)-4-(4-benzoyl-1,4-diazepan-1-yl)-3-[(3-methylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 23990654 |
| Molecular Formula | C33H39N5O3 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | N-(4-aminocyclohexyl)-4-(4-benzoyl-1,4-diazepan-1-yl)-3-[(3-methylbenzoyl)amino]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2cc(C(=O)NC3CCC(N)CC3)ccc2N2CCCN(C(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C33H39N5O3/c1-23-7-5-10-25(21-23)32(40)36-29-22-26(31(39)35-28-14-12-27(34)13-15-28)11-16-30(29)37-17-6-18-38(20-19-37)33(41)24-8-3-2-4-9-24/h2-5,7-11,16,21-22,27-28H,6,12-15,17-20,34H2,1H3,(H,35,39)(H,36,40) |
| InChIKey | LOZGAZUBCJBSII-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |