C27H27BrFN3O2 — CID 23913264
N-[3-[[(4-aminocyclohexyl)-(3-fluorobenzoyl)amino]methyl]phenyl]-2-bromobenzamide (PubChem CID 23913264) has the molecular formula C27H27BrFN3O2 and a molecular weight of 524.43 g/mol. Its IUPAC name is N-[3-[[(4-aminocyclohexyl)-(3-fluorobenzoyl)amino]methyl]phenyl]-2-bromobenzamide.
| Compound Name | N-[3-[[(4-aminocyclohexyl)-(3-fluorobenzoyl)amino]methyl]phenyl]-2-bromobenzamide |
|---|---|
| PubChem CID | 23913264 |
| Molecular Formula | C27H27BrFN3O2 |
| Molecular Weight | 524.43 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | N-[3-[[(4-aminocyclohexyl)-(3-fluorobenzoyl)amino]methyl]phenyl]-2-bromobenzamide |
| SMILES | NC1CCC(N(Cc2cccc(NC(=O)c3ccccc3Br)c2)C(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C27H27BrFN3O2/c28-25-10-2-1-9-24(25)26(33)31-22-8-3-5-18(15-22)17-32(23-13-11-21(30)12-14-23)27(34)19-6-4-7-20(29)16-19/h1-10,15-16,21,23H,11-14,17,30H2,(H,31,33) |
| InChIKey | KORCBGJCTOTGNO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.43 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |