C17H27NSi — CID 103438455
N-(cyclopropylmethyl)-N-[(4-trimethylsilylphenyl)methyl]cyclopropanamine (PubChem CID 103438455) has the molecular formula C17H27NSi and a molecular weight of 273.50 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-[(4-trimethylsilylphenyl)methyl]cyclopropanamine.
| Compound Name | N-(cyclopropylmethyl)-N-[(4-trimethylsilylphenyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 103438455 |
| Molecular Formula | C17H27NSi |
| Molecular Weight | 273.50 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | N-(cyclopropylmethyl)-N-[(4-trimethylsilylphenyl)methyl]cyclopropanamine |
| SMILES | C[Si](C)(C)c1ccc(CN(CC2CC2)C2CC2)cc1 |
| InChI | InChI=1S/C17H27NSi/c1-19(2,3)17-10-6-15(7-11-17)13-18(16-8-9-16)12-14-4-5-14/h6-7,10-11,14,16H,4-5,8-9,12-13H2,1-3H3 |
| InChIKey | BPCJKUCATHTZTF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|