C18H25F2NO2S — CID 112840908
N-(cyclohexylmethyl)-N-[[4-(difluoromethylsulfonyl)phenyl]methyl]cyclopropanamine (PubChem CID 112840908) has the molecular formula C18H25F2NO2S and a molecular weight of 357.47 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N-[[4-(difluoromethylsulfonyl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-(cyclohexylmethyl)-N-[[4-(difluoromethylsulfonyl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 112840908 |
| Molecular Formula | C18H25F2NO2S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-(cyclohexylmethyl)-N-[[4-(difluoromethylsulfonyl)phenyl]methyl]cyclopropanamine |
| SMILES | O=S(=O)(c1ccc(CN(CC2CCCCC2)C2CC2)cc1)C(F)F |
| InChI | InChI=1S/C18H25F2NO2S/c19-18(20)24(22,23)17-10-6-15(7-11-17)13-21(16-8-9-16)12-14-4-2-1-3-5-14/h6-7,10-11,14,16,18H,1-5,8-9,12-13H2 |
| InChIKey | IYRRAYOFRJHGJZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |