C15H20F3NO2S — CID 2822183
1-[2-(4-methylphenyl)sulfonylethyl]-4-(trifluoromethyl)piperidine (PubChem CID 2822183) has the molecular formula C15H20F3NO2S and a molecular weight of 335.39 g/mol. Its IUPAC name is 1-[2-(4-methylphenyl)sulfonylethyl]-4-(trifluoromethyl)piperidine.
| Compound Name | 1-[2-(4-methylphenyl)sulfonylethyl]-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 2822183 |
| Molecular Formula | C15H20F3NO2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 1-[2-(4-methylphenyl)sulfonylethyl]-4-(trifluoromethyl)piperidine |
| SMILES | Cc1ccc(S(=O)(=O)CCN2CCC(C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C15H20F3NO2S/c1-12-2-4-14(5-3-12)22(20,21)11-10-19-8-6-13(7-9-19)15(16,17)18/h2-5,13H,6-11H2,1H3 |
| InChIKey | YSHOVNSLNMWOGX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |