C14H21NO4S2 — CID 154455916
1-[2-(4-methylsulfonylphenyl)sulfonylethyl]piperidine (PubChem CID 154455916) has the molecular formula C14H21NO4S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[2-(4-methylsulfonylphenyl)sulfonylethyl]piperidine.
| Compound Name | 1-[2-(4-methylsulfonylphenyl)sulfonylethyl]piperidine |
|---|---|
| PubChem CID | 154455916 |
| Molecular Formula | C14H21NO4S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 1-[2-(4-methylsulfonylphenyl)sulfonylethyl]piperidine |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)CCN2CCCCC2)cc1 |
| InChI | InChI=1S/C14H21NO4S2/c1-20(16,17)13-5-7-14(8-6-13)21(18,19)12-11-15-9-3-2-4-10-15/h5-8H,2-4,9-12H2,1H3 |
| InChIKey | AJCBKKVINAOVFK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |