C12H18ClNO2S — CID 117068077
1-[2-(benzenesulfonyl)ethyl]pyrrolidine;hydrochloride (PubChem CID 117068077) has the molecular formula C12H18ClNO2S and a molecular weight of 275.80 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]pyrrolidine;hydrochloride.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 117068077 |
| Molecular Formula | C12H18ClNO2S |
| Molecular Weight | 275.80 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]pyrrolidine;hydrochloride |
| SMILES | Cl.O=S(=O)(CCN1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C12H17NO2S.ClH/c14-16(15,12-6-2-1-3-7-12)11-10-13-8-4-5-9-13;/h1-3,6-7H,4-5,8-11H2;1H |
| InChIKey | QUDWKRCPOKMWCD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.80 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |