C23H34N2O3S — CID 95327845
[(2R)-2-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]azepan-1-yl]-cyclopropylmethanone (PubChem CID 95327845) has the molecular formula C23H34N2O3S and a molecular weight of 418.60 g/mol. Its IUPAC name is [(2R)-2-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]azepan-1-yl]-cyclopropylmethanone.
| Compound Name | [(2R)-2-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]azepan-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 95327845 |
| Molecular Formula | C23H34N2O3S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | [(2R)-2-[1-[2-(benzenesulfonyl)ethyl]piperidin-4-yl]azepan-1-yl]-cyclopropylmethanone |
| SMILES | O=C(C1CC1)N1CCCCC[C@@H]1C1CCN(CCS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H34N2O3S/c26-23(20-10-11-20)25-14-6-2-5-9-22(25)19-12-15-24(16-13-19)17-18-29(27,28)21-7-3-1-4-8-21/h1,3-4,7-8,19-20,22H,2,5-6,9-18H2/t22-/m1/s1 |
| InChIKey | RGDNBNFLJKAPIL-JOCHJYFZSA-N |
| XLogP | 3.35 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |