C24H38N2O2 — CID 171722445
[4-(2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl)cyclohexyl]-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)methanone (PubChem CID 171722445) has the molecular formula C24H38N2O2 and a molecular weight of 386.58 g/mol. Its IUPAC name is [4-(2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl)cyclohexyl]-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)methanone.
| Compound Name | [4-(2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl)cyclohexyl]-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 171722445 |
| Molecular Formula | C24H38N2O2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | [4-(2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl)cyclohexyl]-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)methanone |
| SMILES | O=C(C1CCC(C(=O)N2CCC3CCCCC32)CC1)N1CCC2CCCCC21 |
| InChI | InChI=1S/C24H38N2O2/c27-23(25-15-13-17-5-1-3-7-21(17)25)19-9-11-20(12-10-19)24(28)26-16-14-18-6-2-4-8-22(18)26/h17-22H,1-16H2 |
| InChIKey | TVKGMRLKUGWIMO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |