C16H28N2O3S — CID 126819210
[(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-(1-ethylsulfonylpiperidin-3-yl)methanone (PubChem CID 126819210) has the molecular formula C16H28N2O3S and a molecular weight of 328.48 g/mol. Its IUPAC name is [(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-(1-ethylsulfonylpiperidin-3-yl)methanone.
| Compound Name | [(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-(1-ethylsulfonylpiperidin-3-yl)methanone |
|---|---|
| PubChem CID | 126819210 |
| Molecular Formula | C16H28N2O3S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | [(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-(1-ethylsulfonylpiperidin-3-yl)methanone |
| SMILES | CCS(=O)(=O)N1CCCC(C(=O)N2CC[C@@H]3CCCC[C@@H]32)C1 |
| InChI | InChI=1S/C16H28N2O3S/c1-2-22(20,21)17-10-5-7-14(12-17)16(19)18-11-9-13-6-3-4-8-15(13)18/h13-15H,2-12H2,1H3/t13-,14?,15-/m0/s1 |
| InChIKey | PVAFMMVWXDHVOI-LWEDLAQUSA-N |
| XLogP | 1.84 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |