C18H32N2O3S — CID 60611038
2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(1-butylsulfonylpiperidin-4-yl)methanone (PubChem CID 60611038) has the molecular formula C18H32N2O3S and a molecular weight of 356.53 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(1-butylsulfonylpiperidin-4-yl)methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(1-butylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 60611038 |
| Molecular Formula | C18H32N2O3S |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(1-butylsulfonylpiperidin-4-yl)methanone |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)N2CCC3CCCCC32)CC1 |
| InChI | InChI=1S/C18H32N2O3S/c1-2-3-14-24(22,23)19-11-8-16(9-12-19)18(21)20-13-10-15-6-4-5-7-17(15)20/h15-17H,2-14H2,1H3 |
| InChIKey | IRKUTBRUJPWYJP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |